About 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol
2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol (PubChem CID 131884667) has the molecular formula C12H14Cl2O3
and a molecular weight of 277.15 g/mol. Its IUPAC name is 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol |
| PubChem CID | 131884667 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol |
| SMILES | Cc1c(O)c(Cl)c(C=CCCCO)c(O)c1Cl |
| InChI | InChI=1S/C12H14Cl2O3/c1-7-9(13)12(17)8(10(14)11(7)16)5-3-2-4-6-15/h3,5,15-17H,2,4,6H2,1H3 |
| InChIKey | IHIROBXLSOAPFU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol?
The IUPAC name of 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol (CID 131884667) is 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol.
What is the SMILES notation for 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol?
The canonical SMILES for 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol is Cc1c(O)c(Cl)c(C=CCCCO)c(O)c1Cl.
What is the InChIKey of 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol?
The InChIKey is IHIROBXLSOAPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O3/c1-7-9(13)12(17)8(10(14)11(7)16)5-3-2-4-6-15/h3,5,15-17H,2,4,6H2,1H3.
What are the key properties of 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol?
2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol has a molecular weight of 277.15 g/mol, XLogP of 3.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-(5-hydroxypent-1-enyl)-6-methylbenzene-1,4-diol is sourced from PubChem (CID 131884667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).