C24H36O10 — CID 131885822
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methyl acetate (PubChem CID 131885822) has the molecular formula C24H36O10 and a molecular weight of 484.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 131885822 |
| Molecular Formula | C24H36O10 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)(C)C2CC=C(C)CC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O10/c1-13-8-10-18(11-9-13)24(6,7)34-23-22(32-17(5)28)21(31-16(4)27)20(30-15(3)26)19(33-23)12-29-14(2)25/h8,18-23H,9-12H2,1-7H3/t18?,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | MNSBEPPUVWJPEY-NWRGTOQLSA-N |
| XLogP | 2.61 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|