C17H16FN6Na2O6P — CID 131886043
CID 131886043 (PubChem CID 131886043) has the molecular formula C17H16FN6Na2O6P and a molecular weight of 496.30 g/mol.
| Compound Name | CID 131886043 |
|---|---|
| PubChem CID | 131886043 |
| Molecular Formula | C17H16FN6Na2O6P |
| Molecular Weight | 496.30 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | — |
| SMILES | Cn1nnc(-c2ccc(-c3ccc(N4C[C@H](COP(=O)(O)O)OC4=O)cc3F)cn2)n1.[Na].[Na] |
| InChI | InChI=1S/C17H16FN6O6P.2Na/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(30-17(24)25)9-29-31(26,27)28;;/h2-7,12H,8-9H2,1H3,(H2,26,27,28);;/t12-;;/m1../s1 |
| InChIKey | NHSCTXMOQKCCIX-CURYUGHLSA-N |
| XLogP | 0.75 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|