About anthracen-2-ylhydrazine;hydrochloride
anthracen-2-ylhydrazine;hydrochloride (PubChem CID 131886112) has the molecular formula C14H13ClN2
and a molecular weight of 244.73 g/mol. Its IUPAC name is anthracen-2-ylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | anthracen-2-ylhydrazine;hydrochloride |
| PubChem CID | 131886112 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | anthracen-2-ylhydrazine;hydrochloride |
| SMILES | Cl.NNc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H12N2.ClH/c15-16-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14;/h1-9,16H,15H2;1H |
| InChIKey | GKZZARWHRQABPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-2-ylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-2-ylhydrazine;hydrochloride?
The IUPAC name of anthracen-2-ylhydrazine;hydrochloride (CID 131886112) is anthracen-2-ylhydrazine;hydrochloride.
What is the SMILES notation for anthracen-2-ylhydrazine;hydrochloride?
The canonical SMILES for anthracen-2-ylhydrazine;hydrochloride is Cl.NNc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracen-2-ylhydrazine;hydrochloride?
The InChIKey is GKZZARWHRQABPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.ClH/c15-16-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14;/h1-9,16H,15H2;1H.
What are the key properties of anthracen-2-ylhydrazine;hydrochloride?
anthracen-2-ylhydrazine;hydrochloride has a molecular weight of 244.73 g/mol, XLogP of 3.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-2-ylhydrazine;hydrochloride is sourced from PubChem (CID 131886112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).