About 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine
4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine (PubChem CID 131886722) has the molecular formula C5H9N3S
and a molecular weight of 143.21 g/mol. Its IUPAC name is 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine.
Molecular Properties
| Compound Name | 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine |
| PubChem CID | 131886722 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine |
| SMILES | CCn1cns/c1=N\C |
| InChI | InChI=1S/C5H9N3S/c1-3-8-4-7-9-5(8)6-2/h4H,3H2,1-2H3/b6-5- |
| InChIKey | KTVDVWDICGKKPZ-WAYWQWQTSA-N |
| XLogP | 0.50 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine?
The IUPAC name of 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine (CID 131886722) is 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine.
What is the SMILES notation for 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine?
The canonical SMILES for 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine is CCn1cns/c1=N\C.
What is the InChIKey of 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine?
The InChIKey is KTVDVWDICGKKPZ-WAYWQWQTSA-N. The full InChI is InChI=1S/C5H9N3S/c1-3-8-4-7-9-5(8)6-2/h4H,3H2,1-2H3/b6-5-.
What are the key properties of 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine?
4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine has a molecular weight of 143.21 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-methyl-1,2,4-thiadiazol-5-imine is sourced from PubChem (CID 131886722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).