About 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole
2-(4-ethylphenyl)-5,7-dimethyl-1H-indole (PubChem CID 131886815) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole.
Molecular Properties
| Compound Name | 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole |
| PubChem CID | 131886815 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole |
| SMILES | CCc1ccc(-c2cc3cc(C)cc(C)c3[nH]2)cc1 |
| InChI | InChI=1S/C18H19N/c1-4-14-5-7-15(8-6-14)17-11-16-10-12(2)9-13(3)18(16)19-17/h5-11,19H,4H2,1-3H3 |
| InChIKey | SNLUSVWLYYPVRP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole?
The IUPAC name of 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole (CID 131886815) is 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole.
What is the SMILES notation for 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole?
The canonical SMILES for 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole is CCc1ccc(-c2cc3cc(C)cc(C)c3[nH]2)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole?
The InChIKey is SNLUSVWLYYPVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N/c1-4-14-5-7-15(8-6-14)17-11-16-10-12(2)9-13(3)18(16)19-17/h5-11,19H,4H2,1-3H3.
What are the key properties of 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole?
2-(4-ethylphenyl)-5,7-dimethyl-1H-indole has a molecular weight of 249.36 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-5,7-dimethyl-1H-indole is sourced from PubChem (CID 131886815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).