C44H55N7O6S — CID 131887046
9-(4-aminobutyl)-3,15-dibenzyl-6-(1-hydroxyethyl)-12-(1H-indol-3-ylmethyl)-16-thia-1,4,7,10,13-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14-pentone (PubChem CID 131887046) has the molecular formula C44H55N7O6S and a molecular weight of 810.03 g/mol. Its IUPAC name is 9-(4-aminobutyl)-3,15-dibenzyl-6-(1-hydroxyethyl)-12-(1H-indol-3-ylmethyl)-16-thia-1,4,7,10,13-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14-pentone.
| Compound Name | 9-(4-aminobutyl)-3,15-dibenzyl-6-(1-hydroxyethyl)-12-(1H-indol-3-ylmethyl)-16-thia-1,4,7,10,13-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 131887046 |
| Molecular Formula | C44H55N7O6S |
| Molecular Weight | 810.03 g/mol |
| Exact Mass | 809.39 |
| IUPAC Name | 9-(4-aminobutyl)-3,15-dibenzyl-6-(1-hydroxyethyl)-12-(1H-indol-3-ylmethyl)-16-thia-1,4,7,10,13-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14-pentone |
| SMILES | CC(O)C1NC(=O)C(CCCCN)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2ccccc2)SCC2CCCN2C(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C44H55N7O6S/c1-28(52)39-43(56)49-37(23-29-13-4-2-5-14-29)44(57)51-22-12-17-32(51)27-58-38(24-30-15-6-3-7-16-30)42(55)48-36(25-31-26-46-34-19-9-8-18-33(31)34)41(54)47-35(40(53)50-39)20-10-11-21-45/h2-9,13-16,18-19,26,28,32,35-39,46,52H,10-12,17,20-25,27,45H2,1H3,(H,47,54)(H,48,55)(H,49,56)(H,50,53) |
| InChIKey | QBPAGJYIVPCGBZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 198.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|