C24H21ClF8O4S — CID 131887051
(2S,4R)-5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-2-ethoxy-4-(4-methylphenyl)-6-phenyl-3,4-dihydro-2H-pyran (PubChem CID 131887051) has the molecular formula C24H21ClF8O4S and a molecular weight of 592.93 g/mol. Its IUPAC name is (2S,4R)-5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-2-ethoxy-4-(4-methylphenyl)-6-phenyl-3,4-dihydro-2H-pyran.
| Compound Name | (2S,4R)-5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-2-ethoxy-4-(4-methylphenyl)-6-phenyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 131887051 |
| Molecular Formula | C24H21ClF8O4S |
| Molecular Weight | 592.93 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | (2S,4R)-5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-2-ethoxy-4-(4-methylphenyl)-6-phenyl-3,4-dihydro-2H-pyran |
| SMILES | CCO[C@@H]1C[C@H](c2ccc(C)cc2)C(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C24H21ClF8O4S/c1-3-36-18-13-17(15-11-9-14(2)10-12-15)20(19(37-18)16-7-5-4-6-8-16)38(34,35)24(32,33)22(28,29)21(26,27)23(25,30)31/h4-12,17-18H,3,13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | LKPOLDNGZASYBY-MSOLQXFVSA-N |
| XLogP | 7.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.93 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|