C22H29NO8 — CID 131887821
3,4-bis(2-methoxyethoxymethoxy)-N-phenylmethoxybenzamide (PubChem CID 131887821) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is 3,4-bis(2-methoxyethoxymethoxy)-N-phenylmethoxybenzamide.
| Compound Name | 3,4-bis(2-methoxyethoxymethoxy)-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 131887821 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3,4-bis(2-methoxyethoxymethoxy)-N-phenylmethoxybenzamide |
| SMILES | COCCOCOc1ccc(C(=O)NOCc2ccccc2)cc1OCOCCOC |
| InChI | InChI=1S/C22H29NO8/c1-25-10-12-27-16-29-20-9-8-19(14-21(20)30-17-28-13-11-26-2)22(24)23-31-15-18-6-4-3-5-7-18/h3-9,14H,10-13,15-17H2,1-2H3,(H,23,24) |
| InChIKey | IWFGCXDASBCSDI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|