C24H34LiO5 — CID 131888045
CID 131888045 (PubChem CID 131888045) has the molecular formula C24H34LiO5 and a molecular weight of 409.47 g/mol.
| Compound Name | CID 131888045 |
|---|---|
| PubChem CID | 131888045 |
| Molecular Formula | C24H34LiO5 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | — |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC(=O)[C@]12C.[Li] |
| InChI | InChI=1S/C24H34O5.Li/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26;/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29);/t13-,14+,16-,17+,18+,22+,23+,24-;/m1./s1 |
| InChIKey | RSVUUSCBRQHSSN-CAOXKPNISA-N |
| XLogP | 3.69 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |