C5HCl7 — CID 131888490
1,1,2,4,5,5,5-heptachloropenta-1,3-diene (PubChem CID 131888490) has the molecular formula C5HCl7 and a molecular weight of 309.23 g/mol. Its IUPAC name is 1,1,2,4,5,5,5-heptachloropenta-1,3-diene.
| Compound Name | 1,1,2,4,5,5,5-heptachloropenta-1,3-diene |
|---|---|
| PubChem CID | 131888490 |
| Molecular Formula | C5HCl7 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 305.79 |
| IUPAC Name | 1,1,2,4,5,5,5-heptachloropenta-1,3-diene |
| SMILES | ClC(=CC(Cl)=C(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5HCl7/c6-2(4(8)9)1-3(7)5(10,11)12/h1H |
| InChIKey | UUVSXXORHFOJIF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|