C25H21NO3 — CID 131888708
2-(1,3-dioxo-2-phenylinden-2-yl)-N-(4-ethylphenyl)acetamide (PubChem CID 131888708) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-phenylinden-2-yl)-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-(1,3-dioxo-2-phenylinden-2-yl)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 131888708 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(1,3-dioxo-2-phenylinden-2-yl)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CC2(c3ccccc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H21NO3/c1-2-17-12-14-19(15-13-17)26-22(27)16-25(18-8-4-3-5-9-18)23(28)20-10-6-7-11-21(20)24(25)29/h3-15H,2,16H2,1H3,(H,26,27) |
| InChIKey | OZSGCSMBZVZLSO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|