C26H36N2O2 — CID 13189011
3-[2-(3-azabicyclo[3.2.2]nonan-3-yl)ethyl]-8-tert-butyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 13189011) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 3-[2-(3-azabicyclo[3.2.2]nonan-3-yl)ethyl]-8-tert-butyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 3-[2-(3-azabicyclo[3.2.2]nonan-3-yl)ethyl]-8-tert-butyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 13189011 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 3-[2-(3-azabicyclo[3.2.2]nonan-3-yl)ethyl]-8-tert-butyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | CC(C)(C)c1ccc2c3c(c(=O)oc2c1)CN(CCN1CC2CCC(CC2)C1)CC3 |
| InChI | InChI=1S/C26H36N2O2/c1-26(2,3)20-8-9-22-21-10-11-27(17-23(21)25(29)30-24(22)14-20)12-13-28-15-18-4-5-19(16-28)7-6-18/h8-9,14,18-19H,4-7,10-13,15-17H2,1-3H3 |
| InChIKey | XZWRXLIHYUDWDN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|