C19H29N3O4 — CID 131890149
1-ethyl-N-[4-methoxy-3-[(2-methoxyacetyl)amino]phenyl]-3-methylpiperidine-3-carboxamide (PubChem CID 131890149) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-ethyl-N-[4-methoxy-3-[(2-methoxyacetyl)amino]phenyl]-3-methylpiperidine-3-carboxamide.
| Compound Name | 1-ethyl-N-[4-methoxy-3-[(2-methoxyacetyl)amino]phenyl]-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 131890149 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-ethyl-N-[4-methoxy-3-[(2-methoxyacetyl)amino]phenyl]-3-methylpiperidine-3-carboxamide |
| SMILES | CCN1CCCC(C)(C(=O)Nc2ccc(OC)c(NC(=O)COC)c2)C1 |
| InChI | InChI=1S/C19H29N3O4/c1-5-22-10-6-9-19(2,13-22)18(24)20-14-7-8-16(26-4)15(11-14)21-17(23)12-25-3/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H,20,24)(H,21,23) |
| InChIKey | YSFCVOQCAQWOKC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |