C12H16F3N3O3 — CID 131890817
8-methyl-2-(4,4,4-trifluorobutanoyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 131890817) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is 8-methyl-2-(4,4,4-trifluorobutanoyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 8-methyl-2-(4,4,4-trifluorobutanoyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 131890817 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 8-methyl-2-(4,4,4-trifluorobutanoyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN1CC(=O)N2CCN(C(=O)CCC(F)(F)F)CC2C1=O |
| InChI | InChI=1S/C12H16F3N3O3/c1-16-7-10(20)18-5-4-17(6-8(18)11(16)21)9(19)2-3-12(13,14)15/h8H,2-7H2,1H3 |
| InChIKey | NWRIGHHVYVOBNL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |