C13H20ClN5O — CID 131892768
1-[4-[[(2-amino-5-chloro-6-methylpyrimidin-4-yl)amino]methyl]piperidin-1-yl]ethanone (PubChem CID 131892768) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 1-[4-[[(2-amino-5-chloro-6-methylpyrimidin-4-yl)amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[(2-amino-5-chloro-6-methylpyrimidin-4-yl)amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 131892768 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[4-[[(2-amino-5-chloro-6-methylpyrimidin-4-yl)amino]methyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(CNc2nc(N)nc(C)c2Cl)CC1 |
| InChI | InChI=1S/C13H20ClN5O/c1-8-11(14)12(18-13(15)17-8)16-7-10-3-5-19(6-4-10)9(2)20/h10H,3-7H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | QEHUDEUADNJQDZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |