C19H30N4O — CID 131893057
N-[[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 131893057) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131893057 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | N-[[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CCN(CC3CC=CCC3)CC2)nn1C |
| InChI | InChI=1S/C19H30N4O/c1-15-12-18(21-22(15)2)19(24)20-13-16-8-10-23(11-9-16)14-17-6-4-3-5-7-17/h3-4,12,16-17H,5-11,13-14H2,1-2H3,(H,20,24) |
| InChIKey | DOYRGHDJLGMDLY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|