C20H24N4S — CID 131893488
2-[2-[1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperidin-2-yl]ethyl]pyridine (PubChem CID 131893488) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is 2-[2-[1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperidin-2-yl]ethyl]pyridine.
| Compound Name | 2-[2-[1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperidin-2-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 131893488 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[2-[1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperidin-2-yl]ethyl]pyridine |
| SMILES | c1ccc(CCC2CCCCN2Cc2ccc(-c3ccn[nH]3)s2)nc1 |
| InChI | InChI=1S/C20H24N4S/c1-3-12-21-16(5-1)7-8-17-6-2-4-14-24(17)15-18-9-10-20(25-18)19-11-13-22-23-19/h1,3,5,9-13,17H,2,4,6-8,14-15H2,(H,22,23) |
| InChIKey | GNJXJTBJYRRGQE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |