C34H45N7O5S — CID 131893746
(14S)-14-benzyl-7-methoxy-19-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]-5-oxa-1,13,16,19,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione (PubChem CID 131893746) has the molecular formula C34H45N7O5S and a molecular weight of 663.85 g/mol. Its IUPAC name is (14S)-14-benzyl-7-methoxy-19-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]-5-oxa-1,13,16,19,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione.
| Compound Name | (14S)-14-benzyl-7-methoxy-19-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]-5-oxa-1,13,16,19,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
|---|---|
| PubChem CID | 131893746 |
| Molecular Formula | C34H45N7O5S |
| Molecular Weight | 663.85 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | (14S)-14-benzyl-7-methoxy-19-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]-5-oxa-1,13,16,19,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
| SMILES | COc1cccc2c1OCCCn1cc(nn1)CCN(C(=O)CSCCN1CCCC1)CCNC(=O)[C@H](Cc1ccccc1)NC2=O |
| InChI | InChI=1S/C34H45N7O5S/c1-45-30-12-7-11-28-32(30)46-21-8-17-41-24-27(37-38-41)13-18-40(31(42)25-47-22-20-39-15-5-6-16-39)19-14-35-34(44)29(36-33(28)43)23-26-9-3-2-4-10-26/h2-4,7,9-12,24,29H,5-6,8,13-23,25H2,1H3,(H,35,44)(H,36,43)/t29-/m0/s1 |
| InChIKey | WEGLFGCGZDEXKL-LJAQVGFWSA-N |
| XLogP | 2.43 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|