About morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone
morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone (PubChem CID 131894267) has the molecular formula C23H29N3O3
and a molecular weight of 395.50 g/mol. Its IUPAC name is morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone |
| PubChem CID | 131894267 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone |
| SMILES | Cc1ccc2nc(C)c(C)c(C(=O)N3CCCC(C(=O)N4CCOCC4)C3)c2c1 |
| InChI | InChI=1S/C23H29N3O3/c1-15-6-7-20-19(13-15)21(16(2)17(3)24-20)23(28)26-8-4-5-18(14-26)22(27)25-9-11-29-12-10-25/h6-7,13,18H,4-5,8-12,14H2,1-3H3 |
| InChIKey | FJZXUUNHGGWGKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone?
The IUPAC name of morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone (CID 131894267) is morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone.
What is the SMILES notation for morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone?
The canonical SMILES for morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone is Cc1ccc2nc(C)c(C)c(C(=O)N3CCCC(C(=O)N4CCOCC4)C3)c2c1.
What is the InChIKey of morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone?
The InChIKey is FJZXUUNHGGWGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O3/c1-15-6-7-20-19(13-15)21(16(2)17(3)24-20)23(28)26-8-4-5-18(14-26)22(27)25-9-11-29-12-10-25/h6-7,13,18H,4-5,8-12,14H2,1-3H3.
What are the key properties of morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone?
morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone has a molecular weight of 395.50 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[1-(2,3,6-trimethylquinoline-4-carbonyl)piperidin-3-yl]methanone is sourced from PubChem (CID 131894267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).