C18H22FN3 — CID 131894979
1-(cyclohexen-1-yl)-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]ethanamine (PubChem CID 131894979) has the molecular formula C18H22FN3 and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]ethanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 131894979 |
| Molecular Formula | C18H22FN3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]ethanamine |
| SMILES | CC(NCc1cn[nH]c1-c1ccc(F)cc1)C1=CCCCC1 |
| InChI | InChI=1S/C18H22FN3/c1-13(14-5-3-2-4-6-14)20-11-16-12-21-22-18(16)15-7-9-17(19)10-8-15/h5,7-10,12-13,20H,2-4,6,11H2,1H3,(H,21,22) |
| InChIKey | BIOBOFKFVYICKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|