C14H26N4O3S — CID 131895648
N-[3-(2-ethylimidazol-1-yl)propyl]-2-(methoxymethyl)pyrrolidine-1-sulfonamide (PubChem CID 131895648) has the molecular formula C14H26N4O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-[3-(2-ethylimidazol-1-yl)propyl]-2-(methoxymethyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-[3-(2-ethylimidazol-1-yl)propyl]-2-(methoxymethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 131895648 |
| Molecular Formula | C14H26N4O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[3-(2-ethylimidazol-1-yl)propyl]-2-(methoxymethyl)pyrrolidine-1-sulfonamide |
| SMILES | CCc1nccn1CCCNS(=O)(=O)N1CCCC1COC |
| InChI | InChI=1S/C14H26N4O3S/c1-3-14-15-8-11-17(14)9-5-7-16-22(19,20)18-10-4-6-13(18)12-21-2/h8,11,13,16H,3-7,9-10,12H2,1-2H3 |
| InChIKey | TYCWRGVAHPTJGG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|