C17H18N6O4S — CID 131896194
2-(4-methyl-N-methylsulfonylanilino)-N-[4-(2H-tetrazol-5-yloxy)phenyl]acetamide (PubChem CID 131896194) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-(4-methyl-N-methylsulfonylanilino)-N-[4-(2H-tetrazol-5-yloxy)phenyl]acetamide.
| Compound Name | 2-(4-methyl-N-methylsulfonylanilino)-N-[4-(2H-tetrazol-5-yloxy)phenyl]acetamide |
|---|---|
| PubChem CID | 131896194 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-(4-methyl-N-methylsulfonylanilino)-N-[4-(2H-tetrazol-5-yloxy)phenyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(Oc3nn[nH]n3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18N6O4S/c1-12-3-7-14(8-4-12)23(28(2,25)26)11-16(24)18-13-5-9-15(10-6-13)27-17-19-21-22-20-17/h3-10H,11H2,1-2H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | WWSIOCZVLSVZTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |