C20H30ClN3O — CID 131896893
1-[3-[[1-(2-chlorophenyl)piperidin-4-yl]amino]piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 131896893) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is 1-[3-[[1-(2-chlorophenyl)piperidin-4-yl]amino]piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-[[1-(2-chlorophenyl)piperidin-4-yl]amino]piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 131896893 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[3-[[1-(2-chlorophenyl)piperidin-4-yl]amino]piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCCC(NC2CCN(c3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C20H30ClN3O/c1-15(2)20(25)24-11-5-6-17(14-24)22-16-9-12-23(13-10-16)19-8-4-3-7-18(19)21/h3-4,7-8,15-17,22H,5-6,9-14H2,1-2H3 |
| InChIKey | BPNZMQCQXVVRFY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |