About N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine
N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine (PubChem CID 131897622) has the molecular formula C13H20N6
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine |
| PubChem CID | 131897622 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine |
| SMILES | CC(C)c1ncc(CN(C)Cc2nncn2C)cn1 |
| InChI | InChI=1S/C13H20N6/c1-10(2)13-14-5-11(6-15-13)7-18(3)8-12-17-16-9-19(12)4/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | PHUAKCUMSCPZJF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine?
The IUPAC name of N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine (CID 131897622) is N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine.
What is the SMILES notation for N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine?
The canonical SMILES for N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine is CC(C)c1ncc(CN(C)Cc2nncn2C)cn1.
What is the InChIKey of N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine?
The InChIKey is PHUAKCUMSCPZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6/c1-10(2)13-14-5-11(6-15-13)7-18(3)8-12-17-16-9-19(12)4/h5-6,9-10H,7-8H2,1-4H3.
What are the key properties of N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine?
N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine has a molecular weight of 260.34 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-(2-propan-2-ylpyrimidin-5-yl)methanamine is sourced from PubChem (CID 131897622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).