C29H34F2N6O3 — CID 131898686
(7S)-7-benzyl-1'-[[4-(difluoromethoxy)phenyl]methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131898686) has the molecular formula C29H34F2N6O3 and a molecular weight of 552.63 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-[[4-(difluoromethoxy)phenyl]methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-[[4-(difluoromethoxy)phenyl]methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131898686 |
| Molecular Formula | C29H34F2N6O3 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (7S)-7-benzyl-1'-[[4-(difluoromethoxy)phenyl]methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | O=C1NCCCn2cc(nn2)CC2(CCN(Cc3ccc(OC(F)F)cc3)CC2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H34F2N6O3/c30-28(31)40-24-9-7-22(8-10-24)19-36-15-11-29(12-16-36)18-23-20-37(35-34-23)14-4-13-32-26(38)25(33-27(29)39)17-21-5-2-1-3-6-21/h1-3,5-10,20,25,28H,4,11-19H2,(H,32,38)(H,33,39)/t25-/m0/s1 |
| InChIKey | UUEZXWGQOKFQBJ-VWLOTQADSA-N |
| XLogP | 2.95 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |