C21H33N5O — CID 131901047
1-(1-methylpiperidin-4-yl)-3-[(1-prop-2-enylpyrrolidin-3-yl)methyl]-1-(pyridin-4-ylmethyl)urea (PubChem CID 131901047) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-3-[(1-prop-2-enylpyrrolidin-3-yl)methyl]-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-(1-methylpiperidin-4-yl)-3-[(1-prop-2-enylpyrrolidin-3-yl)methyl]-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 131901047 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-3-[(1-prop-2-enylpyrrolidin-3-yl)methyl]-1-(pyridin-4-ylmethyl)urea |
| SMILES | C=CCN1CCC(CNC(=O)N(Cc2ccncc2)C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C21H33N5O/c1-3-11-25-14-6-19(16-25)15-23-21(27)26(17-18-4-9-22-10-5-18)20-7-12-24(2)13-8-20/h3-5,9-10,19-20H,1,6-8,11-17H2,2H3,(H,23,27) |
| InChIKey | RLTHPKNPORJPLW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|