C22H24N2O3 — CID 131903028
6-methyl-N-(pyridin-3-ylmethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 131903028) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-methyl-N-(pyridin-3-ylmethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | 6-methyl-N-(pyridin-3-ylmethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 131903028 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 6-methyl-N-(pyridin-3-ylmethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(Cc2cccnc2)C2CCCc3ccccc32)OCCO1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-21(27-13-12-26-16)22(25)24(15-17-6-5-11-23-14-17)20-10-4-8-18-7-2-3-9-19(18)20/h2-3,5-7,9,11,14,20H,4,8,10,12-13,15H2,1H3 |
| InChIKey | VXUGXJONAXETKQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |