C14H20N2S — CID 131903864
1-[(5-ethylthiophen-2-yl)methyl]-3-methylpiperidine-3-carbonitrile (PubChem CID 131903864) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-3-methylpiperidine-3-carbonitrile.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-methylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 131903864 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-methylpiperidine-3-carbonitrile |
| SMILES | CCc1ccc(CN2CCCC(C)(C#N)C2)s1 |
| InChI | InChI=1S/C14H20N2S/c1-3-12-5-6-13(17-12)9-16-8-4-7-14(2,10-15)11-16/h5-6H,3-4,7-9,11H2,1-2H3 |
| InChIKey | AKVFSQQPICMVGC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |