About 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol
2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 131903996) has the molecular formula C17H22N4O
and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 131903996 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | CCCCc1nc(Cn2ccc3ccccc32)n(CCO)n1 |
| InChI | InChI=1S/C17H22N4O/c1-2-3-8-16-18-17(21(19-16)11-12-22)13-20-10-9-14-6-4-5-7-15(14)20/h4-7,9-10,22H,2-3,8,11-13H2,1H3 |
| InChIKey | LVFZKHDBALMEAU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol (CID 131903996) is 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol is CCCCc1nc(Cn2ccc3ccccc32)n(CCO)n1.
What is the InChIKey of 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol?
The InChIKey is LVFZKHDBALMEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O/c1-2-3-8-16-18-17(21(19-16)11-12-22)13-20-10-9-14-6-4-5-7-15(14)20/h4-7,9-10,22H,2-3,8,11-13H2,1H3.
What are the key properties of 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol?
2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol has a molecular weight of 298.39 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-butyl-5-(indol-1-ylmethyl)-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 131903996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).