C22H23N3O2 — CID 131906533
N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-2-(4-oxoquinolin-1-yl)acetamide (PubChem CID 131906533) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-2-(4-oxoquinolin-1-yl)acetamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-2-(4-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 131906533 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-2-(4-oxoquinolin-1-yl)acetamide |
| SMILES | O=C(Cn1ccc(=O)c2ccccc21)NCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H23N3O2/c26-21-11-14-25(20-10-4-2-8-18(20)21)16-22(27)23-12-15-24-13-5-7-17-6-1-3-9-19(17)24/h1-4,6,8-11,14H,5,7,12-13,15-16H2,(H,23,27) |
| InChIKey | DOZPTPBOQNUHCM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |