C23H33N3O3 — CID 131907011
N-[[1-[2-(2-methylbutanoylamino)benzoyl]piperidin-4-yl]methyl]cyclobutanecarboxamide (PubChem CID 131907011) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[[1-[2-(2-methylbutanoylamino)benzoyl]piperidin-4-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[1-[2-(2-methylbutanoylamino)benzoyl]piperidin-4-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 131907011 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[[1-[2-(2-methylbutanoylamino)benzoyl]piperidin-4-yl]methyl]cyclobutanecarboxamide |
| SMILES | CCC(C)C(=O)Nc1ccccc1C(=O)N1CCC(CNC(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H33N3O3/c1-3-16(2)21(27)25-20-10-5-4-9-19(20)23(29)26-13-11-17(12-14-26)15-24-22(28)18-7-6-8-18/h4-5,9-10,16-18H,3,6-8,11-15H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | OKULMQNNZQMMGN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |