C20H23N5O3 — CID 131907140
4-(1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)-6-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 131907140) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)-6-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)-6-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 131907140 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)-6-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | COCCNc1nc(-c2ccc3c(c2)OCO3)cc(-c2c(C)nn(C)c2C)n1 |
| InChI | InChI=1S/C20H23N5O3/c1-12-19(13(2)25(3)24-12)16-10-15(22-20(23-16)21-7-8-26-4)14-5-6-17-18(9-14)28-11-27-17/h5-6,9-10H,7-8,11H2,1-4H3,(H,21,22,23) |
| InChIKey | AVQCYFJXLQTITI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|