C19H26N4O2 — CID 131908048
(2S)-2-acetamido-4-methyl-N-[2-[(2-methylimidazol-1-yl)methyl]phenyl]pentanamide (PubChem CID 131908048) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2S)-2-acetamido-4-methyl-N-[2-[(2-methylimidazol-1-yl)methyl]phenyl]pentanamide.
| Compound Name | (2S)-2-acetamido-4-methyl-N-[2-[(2-methylimidazol-1-yl)methyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 131908048 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2S)-2-acetamido-4-methyl-N-[2-[(2-methylimidazol-1-yl)methyl]phenyl]pentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)Nc1ccccc1Cn1ccnc1C |
| InChI | InChI=1S/C19H26N4O2/c1-13(2)11-18(21-15(4)24)19(25)22-17-8-6-5-7-16(17)12-23-10-9-20-14(23)3/h5-10,13,18H,11-12H2,1-4H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | VMLQAAIVSIBDAF-SFHVURJKSA-N |
| XLogP | 2.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |