C23H23F2N3O — CID 131908439
7-fluoro-N-[2-(2-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methylquinoline-4-carboxamide (PubChem CID 131908439) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is 7-fluoro-N-[2-(2-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methylquinoline-4-carboxamide.
| Compound Name | 7-fluoro-N-[2-(2-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 131908439 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 7-fluoro-N-[2-(2-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(c2ccccc2F)N2CCCC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C23H23F2N3O/c1-15-12-19(17-9-8-16(24)13-21(17)27-15)23(29)26-14-22(28-10-4-5-11-28)18-6-2-3-7-20(18)25/h2-3,6-9,12-13,22H,4-5,10-11,14H2,1H3,(H,26,29) |
| InChIKey | RNEXJMKDDWXURE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |