About 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol
2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol (PubChem CID 131908454) has the molecular formula C19H20FN3O3
and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 131908454 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol |
| SMILES | COc1ccccc1Cc1nc(-c2cccc(OC)c2F)n(CCO)n1 |
| InChI | InChI=1S/C19H20FN3O3/c1-25-15-8-4-3-6-13(15)12-17-21-19(23(22-17)10-11-24)14-7-5-9-16(26-2)18(14)20/h3-9,24H,10-12H2,1-2H3 |
| InChIKey | NYEWATHKGAQEGM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol (CID 131908454) is 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol is COc1ccccc1Cc1nc(-c2cccc(OC)c2F)n(CCO)n1.
What is the InChIKey of 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol?
The InChIKey is NYEWATHKGAQEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O3/c1-25-15-8-4-3-6-13(15)12-17-21-19(23(22-17)10-11-24)14-7-5-9-16(26-2)18(14)20/h3-9,24H,10-12H2,1-2H3.
What are the key properties of 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol?
2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol has a molecular weight of 357.39 g/mol, XLogP of 2.68, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-fluoro-3-methoxyphenyl)-3-[(2-methoxyphenyl)methyl]-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 131908454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).