About 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile
5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile (PubChem CID 131909147) has the molecular formula C9H12N4O2S
and a molecular weight of 240.29 g/mol. Its IUPAC name is 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile |
| PubChem CID | 131909147 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile |
| SMILES | CCS(=O)(=O)N1CCn2nc(C#N)cc2C1 |
| InChI | InChI=1S/C9H12N4O2S/c1-2-16(14,15)12-3-4-13-9(7-12)5-8(6-10)11-13/h5H,2-4,7H2,1H3 |
| InChIKey | PETLCAJMIZVTJV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile?
The IUPAC name of 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile (CID 131909147) is 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile?
The canonical SMILES for 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile is CCS(=O)(=O)N1CCn2nc(C#N)cc2C1.
What is the InChIKey of 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile?
The InChIKey is PETLCAJMIZVTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S/c1-2-16(14,15)12-3-4-13-9(7-12)5-8(6-10)11-13/h5H,2-4,7H2,1H3.
What are the key properties of 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile?
5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile has a molecular weight of 240.29 g/mol, XLogP of -0.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carbonitrile is sourced from PubChem (CID 131909147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).