C16H19ClFN3O — CID 131909336
4-chloro-3-fluoro-N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)benzamide (PubChem CID 131909336) has the molecular formula C16H19ClFN3O and a molecular weight of 323.80 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)benzamide.
| Compound Name | 4-chloro-3-fluoro-N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 131909336 |
| Molecular Formula | C16H19ClFN3O |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-chloro-3-fluoro-N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)benzamide |
| SMILES | CC(C)(C)C(Cn1ccnc1)NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H19ClFN3O/c1-16(2,3)14(9-21-7-6-19-10-21)20-15(22)11-4-5-12(17)13(18)8-11/h4-8,10,14H,9H2,1-3H3,(H,20,22) |
| InChIKey | XTKRXMLBOMGOFP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |