C20H32ClN3O — CID 131912031
1-(2-chlorophenyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]piperidin-4-amine (PubChem CID 131912031) has the molecular formula C20H32ClN3O and a molecular weight of 365.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]piperidin-4-amine.
| Compound Name | 1-(2-chlorophenyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 131912031 |
| Molecular Formula | C20H32ClN3O |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]piperidin-4-amine |
| SMILES | COCCN1CCCC(CNC2CCN(c3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C20H32ClN3O/c1-25-14-13-23-10-4-5-17(16-23)15-22-18-8-11-24(12-9-18)20-7-3-2-6-19(20)21/h2-3,6-7,17-18,22H,4-5,8-16H2,1H3 |
| InChIKey | BQSVUAOFGQXOCH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |