C32H41N5O7 — CID 131912154
(3S,12S,15S,17R)-12-benzyl-3-[(2S)-butan-2-yl]-17-hydroxy-7-[2-(3-hydroxyphenyl)acetyl]-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,11,14-tetrone (PubChem CID 131912154) has the molecular formula C32H41N5O7 and a molecular weight of 607.71 g/mol. Its IUPAC name is (3S,12S,15S,17R)-12-benzyl-3-[(2S)-butan-2-yl]-17-hydroxy-7-[2-(3-hydroxyphenyl)acetyl]-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,11,14-tetrone.
| Compound Name | (3S,12S,15S,17R)-12-benzyl-3-[(2S)-butan-2-yl]-17-hydroxy-7-[2-(3-hydroxyphenyl)acetyl]-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,11,14-tetrone |
|---|---|
| PubChem CID | 131912154 |
| Molecular Formula | C32H41N5O7 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | (3S,12S,15S,17R)-12-benzyl-3-[(2S)-butan-2-yl]-17-hydroxy-7-[2-(3-hydroxyphenyl)acetyl]-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,11,14-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CN(C(=O)Cc2cccc(O)c2)CCNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2C[C@@H](O)CN2C1=O |
| InChI | InChI=1S/C32H41N5O7/c1-3-20(2)29-32(44)37-18-24(39)17-26(37)31(43)34-25(15-21-8-5-4-6-9-21)30(42)33-12-13-36(19-27(40)35-29)28(41)16-22-10-7-11-23(38)14-22/h4-11,14,20,24-26,29,38-39H,3,12-13,15-19H2,1-2H3,(H,33,42)(H,34,43)(H,35,40)/t20-,24+,25-,26-,29-/m0/s1 |
| InChIKey | CHWKGEPJUWYINS-LNYLFBOLSA-N |
| XLogP | 0.11 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |