About [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone
[4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 131912263) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 131912263 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CCCc1cc(CNC2CCN(C(=O)c3cccs3)CC2)on1 |
| InChI | InChI=1S/C17H23N3O2S/c1-2-4-14-11-15(22-19-14)12-18-13-6-8-20(9-7-13)17(21)16-5-3-10-23-16/h3,5,10-11,13,18H,2,4,6-9,12H2,1H3 |
| InChIKey | OKJCRAPOVVACAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone (CID 131912263) is [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone is CCCc1cc(CNC2CCN(C(=O)c3cccs3)CC2)on1.
What is the InChIKey of [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone?
The InChIKey is OKJCRAPOVVACAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-2-4-14-11-15(22-19-14)12-18-13-6-8-20(9-7-13)17(21)16-5-3-10-23-16/h3,5,10-11,13,18H,2,4,6-9,12H2,1H3.
What are the key properties of [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone?
[4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone has a molecular weight of 333.46 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3-propyl-1,2-oxazol-5-yl)methylamino]piperidin-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 131912263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).