C19H30N2O — CID 131912842
N-ethyl-N-[[5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-methoxyphenyl]methyl]ethanamine (PubChem CID 131912842) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-ethyl-N-[[5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-ethyl-N-[[5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 131912842 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-ethyl-N-[[5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-methoxyphenyl]methyl]ethanamine |
| SMILES | CCC1C=CCN1Cc1ccc(OC)c(CN(CC)CC)c1 |
| InChI | InChI=1S/C19H30N2O/c1-5-18-9-8-12-21(18)14-16-10-11-19(22-4)17(13-16)15-20(6-2)7-3/h8-11,13,18H,5-7,12,14-15H2,1-4H3 |
| InChIKey | QHBNGEOCFYYQFF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|