About N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide (PubChem CID 131914780) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide |
| PubChem CID | 131914780 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide |
| SMILES | NC(=O)[C@@H]1CC=CC[C@H]1NC(=O)C1=Cc2ccccc2OC=C1 |
| InChI | InChI=1S/C18H18N2O3/c19-17(21)14-6-2-3-7-15(14)20-18(22)13-9-10-23-16-8-4-1-5-12(16)11-13/h1-5,8-11,14-15H,6-7H2,(H2,19,21)(H,20,22)/t14-,15-/m1/s1 |
| InChIKey | LGDIPDHSDMUDTQ-HUUCEWRRSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide?
The IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide (CID 131914780) is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide.
What is the SMILES notation for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide?
The canonical SMILES for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide is NC(=O)[C@@H]1CC=CC[C@H]1NC(=O)C1=Cc2ccccc2OC=C1.
What is the InChIKey of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide?
The InChIKey is LGDIPDHSDMUDTQ-HUUCEWRRSA-N. The full InChI is InChI=1S/C18H18N2O3/c19-17(21)14-6-2-3-7-15(14)20-18(22)13-9-10-23-16-8-4-1-5-12(16)11-13/h1-5,8-11,14-15H,6-7H2,(H2,19,21)(H,20,22)/t14-,15-/m1/s1.
What are the key properties of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide?
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide has a molecular weight of 310.35 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-benzoxepine-4-carboxamide is sourced from PubChem (CID 131914780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).