C25H28N6O4 — CID 131918259
(12S,15R)-12-benzyl-15-methyl-2-oxa-5,6,7,10,13,16-hexazatricyclo[17.2.2.15,8]tetracosa-1(22),6,8(24),19(23),20-pentaene-11,14,17-trione (PubChem CID 131918259) has the molecular formula C25H28N6O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is (12S,15R)-12-benzyl-15-methyl-2-oxa-5,6,7,10,13,16-hexazatricyclo[17.2.2.15,8]tetracosa-1(22),6,8(24),19(23),20-pentaene-11,14,17-trione.
| Compound Name | (12S,15R)-12-benzyl-15-methyl-2-oxa-5,6,7,10,13,16-hexazatricyclo[17.2.2.15,8]tetracosa-1(22),6,8(24),19(23),20-pentaene-11,14,17-trione |
|---|---|
| PubChem CID | 131918259 |
| Molecular Formula | C25H28N6O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (12S,15R)-12-benzyl-15-methyl-2-oxa-5,6,7,10,13,16-hexazatricyclo[17.2.2.15,8]tetracosa-1(22),6,8(24),19(23),20-pentaene-11,14,17-trione |
| SMILES | C[C@H]1NC(=O)Cc2ccc(cc2)OCCn2cc(nn2)CNC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C25H28N6O4/c1-17-24(33)28-22(13-18-5-3-2-4-6-18)25(34)26-15-20-16-31(30-29-20)11-12-35-21-9-7-19(8-10-21)14-23(32)27-17/h2-10,16-17,22H,11-15H2,1H3,(H,26,34)(H,27,32)(H,28,33)/t17-,22+/m1/s1 |
| InChIKey | SNTGDFMQMRKUSE-VGSWGCGISA-N |
| XLogP | 0.76 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|