About N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide
N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide (PubChem CID 131918423) has the molecular formula C11H19N3O4S
and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide.
Molecular Properties
| Compound Name | N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide |
| PubChem CID | 131918423 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide |
| SMILES | CCCc1cc(CNC(=O)CCCS(N)(=O)=O)on1 |
| InChI | InChI=1S/C11H19N3O4S/c1-2-4-9-7-10(18-14-9)8-13-11(15)5-3-6-19(12,16)17/h7H,2-6,8H2,1H3,(H,13,15)(H2,12,16,17) |
| InChIKey | UHRRPZRYSLZEPV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide?
The IUPAC name of N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide (CID 131918423) is N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide.
What is the SMILES notation for N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide?
The canonical SMILES for N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide is CCCc1cc(CNC(=O)CCCS(N)(=O)=O)on1.
What is the InChIKey of N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide?
The InChIKey is UHRRPZRYSLZEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O4S/c1-2-4-9-7-10(18-14-9)8-13-11(15)5-3-6-19(12,16)17/h7H,2-6,8H2,1H3,(H,13,15)(H2,12,16,17).
What are the key properties of N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide?
N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide has a molecular weight of 289.36 g/mol, XLogP of 0.31, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-propyl-1,2-oxazol-5-yl)methyl]-4-sulfamoylbutanamide is sourced from PubChem (CID 131918423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).