C15H22F3N3O — CID 131919569
[1-[3-[[4-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperidin-3-yl]methanol (PubChem CID 131919569) has the molecular formula C15H22F3N3O and a molecular weight of 317.35 g/mol. Its IUPAC name is [1-[3-[[4-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperidin-3-yl]methanol.
| Compound Name | [1-[3-[[4-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 131919569 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [1-[3-[[4-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(CCCNc2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C15H22F3N3O/c16-15(17,18)13-4-6-20-14(9-13)19-5-2-8-21-7-1-3-12(10-21)11-22/h4,6,9,12,22H,1-3,5,7-8,10-11H2,(H,19,20) |
| InChIKey | FHKXDAKCMDSIFJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|