C16H17FN4O2 — CID 131920050
N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-fluoropyridine-3-carboxamide (PubChem CID 131920050) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 131920050 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-fluoropyridine-3-carboxamide |
| SMILES | CN(C)CC(=O)Nc1ccc(NC(=O)c2cncc(F)c2)cc1 |
| InChI | InChI=1S/C16H17FN4O2/c1-21(2)10-15(22)19-13-3-5-14(6-4-13)20-16(23)11-7-12(17)9-18-8-11/h3-9H,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | VHXIXPLZRYKLQA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |