C26H25F3N6O9 — CID 13192089
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(6-benzamidopurin-9-yl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 13192089) has the molecular formula C26H25F3N6O9 and a molecular weight of 622.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(6-benzamidopurin-9-yl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(6-benzamidopurin-9-yl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 13192089 |
| Molecular Formula | C26H25F3N6O9 |
| Molecular Weight | 622.51 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(6-benzamidopurin-9-yl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](NC(=O)C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H25F3N6O9/c1-12(36)41-9-16-19(42-13(2)37)20(43-14(3)38)17(33-25(40)26(27,28)29)24(44-16)35-11-32-18-21(30-10-31-22(18)35)34-23(39)15-7-5-4-6-8-15/h4-8,10-11,16-17,19-20,24H,9H2,1-3H3,(H,33,40)(H,30,31,34,39)/t16-,17-,19-,20-,24-/m1/s1 |
| InChIKey | WKKDMYPQPHLAGZ-BNCYDMKUSA-N |
| XLogP | 1.45 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.51 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|