C28H30N4O4 — CID 131921195
(10S,14S)-18-cyclopropyl-12-(1H-pyrrole-2-carbonyl)-2,9-dioxa-12,15,18-triazatetracyclo[18.3.1.13,7.010,14]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-16-one (PubChem CID 131921195) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is (10S,14S)-18-cyclopropyl-12-(1H-pyrrole-2-carbonyl)-2,9-dioxa-12,15,18-triazatetracyclo[18.3.1.13,7.010,14]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-16-one.
| Compound Name | (10S,14S)-18-cyclopropyl-12-(1H-pyrrole-2-carbonyl)-2,9-dioxa-12,15,18-triazatetracyclo[18.3.1.13,7.010,14]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-16-one |
|---|---|
| PubChem CID | 131921195 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (10S,14S)-18-cyclopropyl-12-(1H-pyrrole-2-carbonyl)-2,9-dioxa-12,15,18-triazatetracyclo[18.3.1.13,7.010,14]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-16-one |
| SMILES | O=C1CN(C2CC2)Cc2cccc(c2)Oc2cccc(c2)CO[C@H]2CN(C(=O)c3ccc[nH]3)C[C@@H]2N1 |
| InChI | InChI=1S/C28H30N4O4/c33-27-17-31(21-9-10-21)14-19-4-1-6-22(12-19)36-23-7-2-5-20(13-23)18-35-26-16-32(15-25(26)30-27)28(34)24-8-3-11-29-24/h1-8,11-13,21,25-26,29H,9-10,14-18H2,(H,30,33)/t25-,26-/m0/s1 |
| InChIKey | RFGHVQXZOQWTLA-UIOOFZCWSA-N |
| XLogP | 3.31 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |