C32H40N6O6 — CID 131921429
(10S,15S)-12-[(2-ethylpyrimidin-4-yl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione (PubChem CID 131921429) has the molecular formula C32H40N6O6 and a molecular weight of 604.71 g/mol. Its IUPAC name is (10S,15S)-12-[(2-ethylpyrimidin-4-yl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione.
| Compound Name | (10S,15S)-12-[(2-ethylpyrimidin-4-yl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
|---|---|
| PubChem CID | 131921429 |
| Molecular Formula | C32H40N6O6 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (10S,15S)-12-[(2-ethylpyrimidin-4-yl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
| SMILES | CCc1nccc(CN2CC[C@@H]3NC(=O)NCCNC(=O)c4cc(OCCOC)cc(c4)Oc4cccc(c4)CO[C@H]3C2)n1 |
| InChI | InChI=1S/C32H40N6O6/c1-3-30-33-9-7-24(36-30)19-38-12-8-28-29(20-38)43-21-22-5-4-6-25(15-22)44-27-17-23(16-26(18-27)42-14-13-41-2)31(39)34-10-11-35-32(40)37-28/h4-7,9,15-18,28-29H,3,8,10-14,19-21H2,1-2H3,(H,34,39)(H2,35,37,40)/t28-,29-/m0/s1 |
| InChIKey | OFDLQLVDMYSWIG-VMPREFPWSA-N |
| XLogP | 3.06 |
| TPSA | 136.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|